Indoline-5-carboxylic acid
2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID
CAS: 15861-30-0
Molecular Formula: C9H9NO2
Indoline-5-carboxylic acid - Names and Identifiers
| Name | 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID |
| Synonyms | 5-carboxylindoline INDOLINE-5-CARBOXYLIC ACID Indoline-5-carboxylic acid 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID 1H-Indole-5-carboxylic acid, 2,3-dihydro- 2,3-Dihydro-1H-indole-5-carboxylic acid methyl ester |
| CAS | 15861-30-0 |
| InChI | InChI=1/C9H9NO2/c11-9(12)7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2,(H,11,12) |
Indoline-5-carboxylic acid - Physico-chemical Properties
| Molecular Formula | C9H9NO2 |
| Molar Mass | 163.17 |
| Density | 1.284g/cm3 |
| Boling Point | 369.037°C at 760 mmHg |
| Flash Point | 176.987°C |
| Vapor Presure | 0mmHg at 25°C |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.611 |
Indoline-5-carboxylic acid - Risk and Safety
| Hazard Symbols | T - Toxic |
| Risk Codes | 25 - Toxic if swallowed |
| Safety Description | 45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| HS Code | 29349990 |
Indoline-5-carboxylic acid - Introduction
2. The ACID, often abbreviated as 5-carboxy-ida, has the following properties and uses:
Nature:
1. 5-carboxy-ida is an organic compound with the molecular formula C9H6NO2.
2. It is a yellowish solid, soluble in some organic solvents, such as chloroform, dichloromethane, etc.
3. 5-Carboxy-ida is a weak acid, which can react with alkali to form the corresponding salt.
4. This compound can undergo redox reactions and form complexes with metals.
Use:
1. 5-Carboxy-ida is commonly used in ligand chemistry in the field of chemical analysis, especially as a ligand for metal ions.
2. It can be used as a chelating agent for complex catalysis, metal hydrophobic modification and other fields.
3. 5-carboxy-IDA can also be used as an intermediate in organic synthesis.
Method:
The synthesis of 5-carboxy-ida is usually completed by introducing a carboxyl group on the indole ring. A common synthetic method is the acylation of indole with alkyl ketone, followed by reduction and carboxylation to obtain the target product.
Safety Information:
Since there is no specific safety data for reference, regular chemical protection measures should be taken when handling 5-carboxy-ida. This includes wearing protective goggles, gloves and laboratory coats, and ensuring that the operation is carried out in a well-ventilated area. If contact with skin or eyes, rinse with plenty of water and seek medical help if necessary. Observe local regulations and safe operating procedures.
Nature:
1. 5-carboxy-ida is an organic compound with the molecular formula C9H6NO2.
2. It is a yellowish solid, soluble in some organic solvents, such as chloroform, dichloromethane, etc.
3. 5-Carboxy-ida is a weak acid, which can react with alkali to form the corresponding salt.
4. This compound can undergo redox reactions and form complexes with metals.
Use:
1. 5-Carboxy-ida is commonly used in ligand chemistry in the field of chemical analysis, especially as a ligand for metal ions.
2. It can be used as a chelating agent for complex catalysis, metal hydrophobic modification and other fields.
3. 5-carboxy-IDA can also be used as an intermediate in organic synthesis.
Method:
The synthesis of 5-carboxy-ida is usually completed by introducing a carboxyl group on the indole ring. A common synthetic method is the acylation of indole with alkyl ketone, followed by reduction and carboxylation to obtain the target product.
Safety Information:
Since there is no specific safety data for reference, regular chemical protection measures should be taken when handling 5-carboxy-ida. This includes wearing protective goggles, gloves and laboratory coats, and ensuring that the operation is carried out in a well-ventilated area. If contact with skin or eyes, rinse with plenty of water and seek medical help if necessary. Observe local regulations and safe operating procedures.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID Visit Supplier Webpage Request for quotationCAS: 15861-30-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID Visit Supplier Webpage Request for quotationCAS: 15861-30-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History